About N-methyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride
N-methyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride (PubChem CID 71756980) has the molecular formula C9H12ClNO2S
and a molecular weight of 233.72 g/mol. Its IUPAC name is N-methyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride.
Molecular Properties
| Compound Name | N-methyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride |
| PubChem CID | 71756980 |
| Molecular Formula | C9H12ClNO2S |
| Molecular Weight | 233.72 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | N-methyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride |
| SMILES | CNC1CS(=O)(=O)c2ccccc21.Cl |
| InChI | InChI=1S/C9H11NO2S.ClH/c1-10-8-6-13(11,12)9-5-3-2-4-7(8)9;/h2-5,8,10H,6H2,1H3;1H |
| InChIKey | SRZWKVDNYWIQBN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.72 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride?
The IUPAC name of N-methyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride (CID 71756980) is N-methyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride.
What is the SMILES notation for N-methyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride?
The canonical SMILES for N-methyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride is CNC1CS(=O)(=O)c2ccccc21.Cl.
What is the InChIKey of N-methyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride?
The InChIKey is SRZWKVDNYWIQBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2S.ClH/c1-10-8-6-13(11,12)9-5-3-2-4-7(8)9;/h2-5,8,10H,6H2,1H3;1H.
What are the key properties of N-methyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride?
N-methyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride has a molecular weight of 233.72 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1,1-dioxo-2,3-dihydro-1-benzothiophen-3-amine;hydrochloride is sourced from PubChem (CID 71756980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).