About 3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride
3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride (PubChem CID 71757016) has the molecular formula C8H7ClN2O3S
and a molecular weight of 246.67 g/mol. Its IUPAC name is 3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride.
Molecular Properties
| Compound Name | 3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride |
| PubChem CID | 71757016 |
| Molecular Formula | C8H7ClN2O3S |
| Molecular Weight | 246.67 g/mol |
| Exact Mass | 245.99 |
| IUPAC Name | 3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride |
| SMILES | CCc1noc2ncc(S(=O)(=O)Cl)cc12 |
| InChI | InChI=1S/C8H7ClN2O3S/c1-2-7-6-3-5(15(9,12)13)4-10-8(6)14-11-7/h3-4H,2H2,1H3 |
| InChIKey | MKTIKWLANFECEW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.67 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride?
The IUPAC name of 3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride (CID 71757016) is 3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride.
What is the SMILES notation for 3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride?
The canonical SMILES for 3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride is CCc1noc2ncc(S(=O)(=O)Cl)cc12.
What is the InChIKey of 3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride?
The InChIKey is MKTIKWLANFECEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN2O3S/c1-2-7-6-3-5(15(9,12)13)4-10-8(6)14-11-7/h3-4H,2H2,1H3.
What are the key properties of 3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride?
3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride has a molecular weight of 246.67 g/mol, XLogP of 1.71, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride is sourced from PubChem (CID 71757016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).