About 3-phenyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride
3-phenyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride (PubChem CID 71757017) has the molecular formula C12H7ClN2O3S
and a molecular weight of 294.72 g/mol. Its IUPAC name is 3-phenyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride.
Molecular Properties
| Compound Name | 3-phenyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride |
| PubChem CID | 71757017 |
| Molecular Formula | C12H7ClN2O3S |
| Molecular Weight | 294.72 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | 3-phenyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cnc2onc(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C12H7ClN2O3S/c13-19(16,17)9-6-10-11(8-4-2-1-3-5-8)15-18-12(10)14-7-9/h1-7H |
| InChIKey | RMENGPPTHWFIPN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.72 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-phenyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride?
The IUPAC name of 3-phenyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride (CID 71757017) is 3-phenyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride.
What is the SMILES notation for 3-phenyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride?
The canonical SMILES for 3-phenyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride is O=S(=O)(Cl)c1cnc2onc(-c3ccccc3)c2c1.
What is the InChIKey of 3-phenyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride?
The InChIKey is RMENGPPTHWFIPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7ClN2O3S/c13-19(16,17)9-6-10-11(8-4-2-1-3-5-8)15-18-12(10)14-7-9/h1-7H.
What are the key properties of 3-phenyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride?
3-phenyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride has a molecular weight of 294.72 g/mol, XLogP of 2.82, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-[1,2]oxazolo[5,4-b]pyridine-5-sulfonyl chloride is sourced from PubChem (CID 71757017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).