About 3-(Propan-2-yl)azetidine hydrochloride
3-(Propan-2-yl)azetidine hydrochloride (PubChem CID 71757114) has the molecular formula C6H14ClN
and a molecular weight of 135.63 g/mol. Its IUPAC name is 3-propan-2-ylazetidine;hydrochloride.
Molecular Properties
| Compound Name | 3-(Propan-2-yl)azetidine hydrochloride |
| PubChem CID | 71757114 |
| Molecular Formula | C6H14ClN |
| Molecular Weight | 135.63 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 3-propan-2-ylazetidine;hydrochloride |
| SMILES | CC(C)C1CNC1.Cl |
| InChI | InChI=1S/C6H13N.ClH/c1-5(2)6-3-7-4-6;/h5-7H,3-4H2,1-2H3;1H |
| InChIKey | PCMYOLGVIVGJBO-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 12.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | 55 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(Propan-2-yl)azetidine hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(Propan-2-yl)azetidine hydrochloride?
The IUPAC name of 3-(Propan-2-yl)azetidine hydrochloride (CID 71757114) is 3-propan-2-ylazetidine;hydrochloride.
What is the SMILES notation for 3-(Propan-2-yl)azetidine hydrochloride?
The canonical SMILES for 3-(Propan-2-yl)azetidine hydrochloride is CC(C)C1CNC1.Cl.
What is the InChIKey of 3-(Propan-2-yl)azetidine hydrochloride?
The InChIKey is PCMYOLGVIVGJBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.ClH/c1-5(2)6-3-7-4-6;/h5-7H,3-4H2,1-2H3;1H.
What are the key properties of 3-(Propan-2-yl)azetidine hydrochloride?
3-(Propan-2-yl)azetidine hydrochloride has a molecular weight of 135.63 g/mol, XLogP of not available, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(Propan-2-yl)azetidine hydrochloride is sourced from PubChem (CID 71757114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).