About spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-amine
spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-amine (PubChem CID 71757180) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-amine.
Molecular Properties
| Compound Name | spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-amine |
| PubChem CID | 71757180 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-amine |
| SMILES | NC1C2CCOC2C12CCCC2 |
| InChI | InChI=1S/C10H17NO/c11-8-7-3-6-12-9(7)10(8)4-1-2-5-10/h7-9H,1-6,11H2 |
| InChIKey | SECNRCAOCKDXOF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-amine?
The IUPAC name of spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-amine (CID 71757180) is spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-amine.
What is the SMILES notation for spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-amine?
The canonical SMILES for spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-amine is NC1C2CCOC2C12CCCC2.
What is the InChIKey of spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-amine?
The InChIKey is SECNRCAOCKDXOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c11-8-7-3-6-12-9(7)10(8)4-1-2-5-10/h7-9H,1-6,11H2.
What are the key properties of spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-amine?
spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-amine has a molecular weight of 167.25 g/mol, XLogP of 1.29, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[2-oxabicyclo[3.2.0]heptane-7,1'-cyclopentane]-6-amine is sourced from PubChem (CID 71757180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).