About 5-bromo-7-chloro-2-oxo-3H-1,3-benzoxazole-6-sulfonyl chloride
5-bromo-7-chloro-2-oxo-3H-1,3-benzoxazole-6-sulfonyl chloride (PubChem CID 71757294) has the molecular formula C7H2BrCl2NO4S
and a molecular weight of 346.97 g/mol. Its IUPAC name is 5-bromo-7-chloro-2-oxo-3H-1,3-benzoxazole-6-sulfonyl chloride.
Molecular Properties
| Compound Name | 5-bromo-7-chloro-2-oxo-3H-1,3-benzoxazole-6-sulfonyl chloride |
| PubChem CID | 71757294 |
| Molecular Formula | C7H2BrCl2NO4S |
| Molecular Weight | 346.97 g/mol |
| Exact Mass | 344.83 |
| IUPAC Name | 5-bromo-7-chloro-2-oxo-3H-1,3-benzoxazole-6-sulfonyl chloride |
| SMILES | O=c1[nH]c2cc(Br)c(S(=O)(=O)Cl)c(Cl)c2o1 |
| InChI | InChI=1S/C7H2BrCl2NO4S/c8-2-1-3-5(15-7(12)11-3)4(9)6(2)16(10,13)14/h1H,(H,11,12) |
| InChIKey | BSWJSKVRMYJKFB-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 80.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.97 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-7-chloro-2-oxo-3H-1,3-benzoxazole-6-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-7-chloro-2-oxo-3H-1,3-benzoxazole-6-sulfonyl chloride?
The IUPAC name of 5-bromo-7-chloro-2-oxo-3H-1,3-benzoxazole-6-sulfonyl chloride (CID 71757294) is 5-bromo-7-chloro-2-oxo-3H-1,3-benzoxazole-6-sulfonyl chloride.
What is the SMILES notation for 5-bromo-7-chloro-2-oxo-3H-1,3-benzoxazole-6-sulfonyl chloride?
The canonical SMILES for 5-bromo-7-chloro-2-oxo-3H-1,3-benzoxazole-6-sulfonyl chloride is O=c1[nH]c2cc(Br)c(S(=O)(=O)Cl)c(Cl)c2o1.
What is the InChIKey of 5-bromo-7-chloro-2-oxo-3H-1,3-benzoxazole-6-sulfonyl chloride?
The InChIKey is BSWJSKVRMYJKFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2BrCl2NO4S/c8-2-1-3-5(15-7(12)11-3)4(9)6(2)16(10,13)14/h1H,(H,11,12).
What are the key properties of 5-bromo-7-chloro-2-oxo-3H-1,3-benzoxazole-6-sulfonyl chloride?
5-bromo-7-chloro-2-oxo-3H-1,3-benzoxazole-6-sulfonyl chloride has a molecular weight of 346.97 g/mol, XLogP of 2.46, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-7-chloro-2-oxo-3H-1,3-benzoxazole-6-sulfonyl chloride is sourced from PubChem (CID 71757294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).