About 2-[[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]azaniumyl]acetate
2-[[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]azaniumyl]acetate (PubChem CID 7175731) has the molecular formula C6H9NO4S
and a molecular weight of 191.21 g/mol. Its IUPAC name is 2-[[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]azaniumyl]acetate.
Molecular Properties
| Compound Name | 2-[[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]azaniumyl]acetate |
| PubChem CID | 7175731 |
| Molecular Formula | C6H9NO4S |
| Molecular Weight | 191.21 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | 2-[[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]azaniumyl]acetate |
| SMILES | O=C([O-])C[NH2+][C@@H]1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C6H9NO4S/c8-6(9)3-7-5-1-2-12(10,11)4-5/h1-2,5,7H,3-4H2,(H,8,9)/t5-/m1/s1 |
| InChIKey | SKCKHIKDKBWSEK-RXMQYKEDSA-N |
| XLogP | -3.39 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.21 |
| LogP ≤ 5 | -3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]azaniumyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]azaniumyl]acetate?
The IUPAC name of 2-[[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]azaniumyl]acetate (CID 7175731) is 2-[[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]azaniumyl]acetate.
What is the SMILES notation for 2-[[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]azaniumyl]acetate?
The canonical SMILES for 2-[[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]azaniumyl]acetate is O=C([O-])C[NH2+][C@@H]1C=CS(=O)(=O)C1.
What is the InChIKey of 2-[[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]azaniumyl]acetate?
The InChIKey is SKCKHIKDKBWSEK-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H9NO4S/c8-6(9)3-7-5-1-2-12(10,11)4-5/h1-2,5,7H,3-4H2,(H,8,9)/t5-/m1/s1.
What are the key properties of 2-[[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]azaniumyl]acetate?
2-[[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]azaniumyl]acetate has a molecular weight of 191.21 g/mol, XLogP of -3.39, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(3R)-1,1-dioxo-2,3-dihydrothiophen-3-yl]azaniumyl]acetate is sourced from PubChem (CID 7175731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).