About [2-(2,2-difluoroethoxy)-4-pyridinyl]methanamine
[2-(2,2-difluoroethoxy)-4-pyridinyl]methanamine (PubChem CID 71757333) has the molecular formula C8H10F2N2O
and a molecular weight of 188.18 g/mol. Its IUPAC name is [2-(2,2-difluoroethoxy)-4-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [2-(2,2-difluoroethoxy)-4-pyridinyl]methanamine |
| PubChem CID | 71757333 |
| Molecular Formula | C8H10F2N2O |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | [2-(2,2-difluoroethoxy)-4-pyridinyl]methanamine |
| SMILES | NCc1ccnc(OCC(F)F)c1 |
| InChI | InChI=1S/C8H10F2N2O/c9-7(10)5-13-8-3-6(4-11)1-2-12-8/h1-3,7H,4-5,11H2 |
| InChIKey | HBVFKNAVLMBSQI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(2,2-difluoroethoxy)-4-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,2-difluoroethoxy)-4-pyridinyl]methanamine?
The IUPAC name of [2-(2,2-difluoroethoxy)-4-pyridinyl]methanamine (CID 71757333) is [2-(2,2-difluoroethoxy)-4-pyridinyl]methanamine.
What is the SMILES notation for [2-(2,2-difluoroethoxy)-4-pyridinyl]methanamine?
The canonical SMILES for [2-(2,2-difluoroethoxy)-4-pyridinyl]methanamine is NCc1ccnc(OCC(F)F)c1.
What is the InChIKey of [2-(2,2-difluoroethoxy)-4-pyridinyl]methanamine?
The InChIKey is HBVFKNAVLMBSQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F2N2O/c9-7(10)5-13-8-3-6(4-11)1-2-12-8/h1-3,7H,4-5,11H2.
What are the key properties of [2-(2,2-difluoroethoxy)-4-pyridinyl]methanamine?
[2-(2,2-difluoroethoxy)-4-pyridinyl]methanamine has a molecular weight of 188.18 g/mol, XLogP of 1.18, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,2-difluoroethoxy)-4-pyridinyl]methanamine is sourced from PubChem (CID 71757333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).