About 6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine;hydrochloride
6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine;hydrochloride (PubChem CID 71757381) has the molecular formula C13H17Cl2NO2
and a molecular weight of 290.19 g/mol. Its IUPAC name is 6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine;hydrochloride.
Molecular Properties
| Compound Name | 6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine;hydrochloride |
| PubChem CID | 71757381 |
| Molecular Formula | C13H17Cl2NO2 |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine;hydrochloride |
| SMILES | Cl.Clc1cc2c(cc1NC1CCCCC1)OCO2 |
| InChI | InChI=1S/C13H16ClNO2.ClH/c14-10-6-12-13(17-8-16-12)7-11(10)15-9-4-2-1-3-5-9;/h6-7,9,15H,1-5,8H2;1H |
| InChIKey | SQDPMYFTFYMFGJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine;hydrochloride?
The IUPAC name of 6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine;hydrochloride (CID 71757381) is 6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine;hydrochloride.
What is the SMILES notation for 6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine;hydrochloride?
The canonical SMILES for 6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine;hydrochloride is Cl.Clc1cc2c(cc1NC1CCCCC1)OCO2.
What is the InChIKey of 6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine;hydrochloride?
The InChIKey is SQDPMYFTFYMFGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClNO2.ClH/c14-10-6-12-13(17-8-16-12)7-11(10)15-9-4-2-1-3-5-9;/h6-7,9,15H,1-5,8H2;1H.
What are the key properties of 6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine;hydrochloride?
6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine;hydrochloride has a molecular weight of 290.19 g/mol, XLogP of 4.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-cyclohexyl-1,3-benzodioxol-5-amine;hydrochloride is sourced from PubChem (CID 71757381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).