About 2-(5-chloro-1-methylimidazol-2-yl)-2,2-difluoroacetic acid;hydrochloride
2-(5-chloro-1-methylimidazol-2-yl)-2,2-difluoroacetic acid;hydrochloride (PubChem CID 71757498) has the molecular formula C6H6Cl2F2N2O2
and a molecular weight of 247.03 g/mol. Its IUPAC name is 2-(5-chloro-1-methylimidazol-2-yl)-2,2-difluoroacetic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-(5-chloro-1-methylimidazol-2-yl)-2,2-difluoroacetic acid;hydrochloride |
| PubChem CID | 71757498 |
| Molecular Formula | C6H6Cl2F2N2O2 |
| Molecular Weight | 247.03 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | 2-(5-chloro-1-methylimidazol-2-yl)-2,2-difluoroacetic acid;hydrochloride |
| SMILES | Cl.Cn1c(Cl)cnc1C(F)(F)C(=O)O |
| InChI | InChI=1S/C6H5ClF2N2O2.ClH/c1-11-3(7)2-10-4(11)6(8,9)5(12)13;/h2H,1H3,(H,12,13);1H |
| InChIKey | XPHXFQODIAVFDY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.03 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5-chloro-1-methylimidazol-2-yl)-2,2-difluoroacetic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloro-1-methylimidazol-2-yl)-2,2-difluoroacetic acid;hydrochloride?
The IUPAC name of 2-(5-chloro-1-methylimidazol-2-yl)-2,2-difluoroacetic acid;hydrochloride (CID 71757498) is 2-(5-chloro-1-methylimidazol-2-yl)-2,2-difluoroacetic acid;hydrochloride.
What is the SMILES notation for 2-(5-chloro-1-methylimidazol-2-yl)-2,2-difluoroacetic acid;hydrochloride?
The canonical SMILES for 2-(5-chloro-1-methylimidazol-2-yl)-2,2-difluoroacetic acid;hydrochloride is Cl.Cn1c(Cl)cnc1C(F)(F)C(=O)O.
What is the InChIKey of 2-(5-chloro-1-methylimidazol-2-yl)-2,2-difluoroacetic acid;hydrochloride?
The InChIKey is XPHXFQODIAVFDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClF2N2O2.ClH/c1-11-3(7)2-10-4(11)6(8,9)5(12)13;/h2H,1H3,(H,12,13);1H.
What are the key properties of 2-(5-chloro-1-methylimidazol-2-yl)-2,2-difluoroacetic acid;hydrochloride?
2-(5-chloro-1-methylimidazol-2-yl)-2,2-difluoroacetic acid;hydrochloride has a molecular weight of 247.03 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloro-1-methylimidazol-2-yl)-2,2-difluoroacetic acid;hydrochloride is sourced from PubChem (CID 71757498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).