About 6-(2,2-difluoroethoxy)pyridine-2-carboxylic acid
6-(2,2-difluoroethoxy)pyridine-2-carboxylic acid (PubChem CID 71757510) has the molecular formula C8H7F2NO3
and a molecular weight of 203.14 g/mol. Its IUPAC name is 6-(2,2-difluoroethoxy)pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-(2,2-difluoroethoxy)pyridine-2-carboxylic acid |
| PubChem CID | 71757510 |
| Molecular Formula | C8H7F2NO3 |
| Molecular Weight | 203.14 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 6-(2,2-difluoroethoxy)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(OCC(F)F)n1 |
| InChI | InChI=1S/C8H7F2NO3/c9-6(10)4-14-7-3-1-2-5(11-7)8(12)13/h1-3,6H,4H2,(H,12,13) |
| InChIKey | CLGMATKWZACQSQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.14 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(2,2-difluoroethoxy)pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,2-difluoroethoxy)pyridine-2-carboxylic acid?
The IUPAC name of 6-(2,2-difluoroethoxy)pyridine-2-carboxylic acid (CID 71757510) is 6-(2,2-difluoroethoxy)pyridine-2-carboxylic acid.
What is the SMILES notation for 6-(2,2-difluoroethoxy)pyridine-2-carboxylic acid?
The canonical SMILES for 6-(2,2-difluoroethoxy)pyridine-2-carboxylic acid is O=C(O)c1cccc(OCC(F)F)n1.
What is the InChIKey of 6-(2,2-difluoroethoxy)pyridine-2-carboxylic acid?
The InChIKey is CLGMATKWZACQSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F2NO3/c9-6(10)4-14-7-3-1-2-5(11-7)8(12)13/h1-3,6H,4H2,(H,12,13).
What are the key properties of 6-(2,2-difluoroethoxy)pyridine-2-carboxylic acid?
6-(2,2-difluoroethoxy)pyridine-2-carboxylic acid has a molecular weight of 203.14 g/mol, XLogP of 1.42, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,2-difluoroethoxy)pyridine-2-carboxylic acid is sourced from PubChem (CID 71757510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).