About methyl 2-amino-4,4-difluorobutanoate;hydrochloride
methyl 2-amino-4,4-difluorobutanoate;hydrochloride (PubChem CID 71757569) has the molecular formula C5H10ClF2NO2
and a molecular weight of 189.59 g/mol. Its IUPAC name is methyl 2-amino-4,4-difluorobutanoate;hydrochloride.
Molecular Properties
| Compound Name | methyl 2-amino-4,4-difluorobutanoate;hydrochloride |
| PubChem CID | 71757569 |
| Molecular Formula | C5H10ClF2NO2 |
| Molecular Weight | 189.59 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | methyl 2-amino-4,4-difluorobutanoate;hydrochloride |
| SMILES | COC(=O)C(N)CC(F)F.Cl |
| InChI | InChI=1S/C5H9F2NO2.ClH/c1-10-5(9)3(8)2-4(6)7;/h3-4H,2,8H2,1H3;1H |
| InChIKey | LTLMGMDHRNVCAJ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.59 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-amino-4,4-difluorobutanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-amino-4,4-difluorobutanoate;hydrochloride?
The IUPAC name of methyl 2-amino-4,4-difluorobutanoate;hydrochloride (CID 71757569) is methyl 2-amino-4,4-difluorobutanoate;hydrochloride.
What is the SMILES notation for methyl 2-amino-4,4-difluorobutanoate;hydrochloride?
The canonical SMILES for methyl 2-amino-4,4-difluorobutanoate;hydrochloride is COC(=O)C(N)CC(F)F.Cl.
What is the InChIKey of methyl 2-amino-4,4-difluorobutanoate;hydrochloride?
The InChIKey is LTLMGMDHRNVCAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9F2NO2.ClH/c1-10-5(9)3(8)2-4(6)7;/h3-4H,2,8H2,1H3;1H.
What are the key properties of methyl 2-amino-4,4-difluorobutanoate;hydrochloride?
methyl 2-amino-4,4-difluorobutanoate;hydrochloride has a molecular weight of 189.59 g/mol, XLogP of 0.56, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-amino-4,4-difluorobutanoate;hydrochloride is sourced from PubChem (CID 71757569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).