About 1-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride
1-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride (PubChem CID 71757606) has the molecular formula C7H15ClN4
and a molecular weight of 190.68 g/mol. Its IUPAC name is 1-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride |
| PubChem CID | 71757606 |
| Molecular Formula | C7H15ClN4 |
| Molecular Weight | 190.68 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 1-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride |
| SMILES | CC(C)c1n[nH]c(C(C)N)n1.Cl |
| InChI | InChI=1S/C7H14N4.ClH/c1-4(2)6-9-7(5(3)8)11-10-6;/h4-5H,8H2,1-3H3,(H,9,10,11);1H |
| InChIKey | VXIQHNKHIPANPN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.68 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride?
The IUPAC name of 1-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride (CID 71757606) is 1-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride.
What is the SMILES notation for 1-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride?
The canonical SMILES for 1-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride is CC(C)c1n[nH]c(C(C)N)n1.Cl.
What is the InChIKey of 1-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride?
The InChIKey is VXIQHNKHIPANPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4.ClH/c1-4(2)6-9-7(5(3)8)11-10-6;/h4-5H,8H2,1-3H3,(H,9,10,11);1H.
What are the key properties of 1-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride?
1-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride has a molecular weight of 190.68 g/mol, XLogP of 1.37, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-propan-2-yl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride is sourced from PubChem (CID 71757606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).