C9H14ClNO2 — CID 71757652
2-chloro-1-(3-cyclopropylmorpholin-4-yl)ethanone (PubChem CID 71757652) has the molecular formula C9H14ClNO2 and a molecular weight of 203.67 g/mol. Its IUPAC name is 2-chloro-1-(3-cyclopropylmorpholin-4-yl)ethanone.
| Compound Name | 2-chloro-1-(3-cyclopropylmorpholin-4-yl)ethanone |
|---|---|
| PubChem CID | 71757652 |
| Molecular Formula | C9H14ClNO2 |
| Molecular Weight | 203.67 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 2-chloro-1-(3-cyclopropylmorpholin-4-yl)ethanone |
| SMILES | O=C(CCl)N1CCOCC1C1CC1 |
| InChI | InChI=1S/C9H14ClNO2/c10-5-9(12)11-3-4-13-6-8(11)7-1-2-7/h7-8H,1-6H2 |
| InChIKey | CVOKSRFENACETI-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.67 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|