C8H12F2N4 — CID 71757723
[3-(difluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanamine (PubChem CID 71757723) has the molecular formula C8H12F2N4 and a molecular weight of 202.21 g/mol. Its IUPAC name is [3-(difluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanamine.
| Compound Name | [3-(difluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanamine |
|---|---|
| PubChem CID | 71757723 |
| Molecular Formula | C8H12F2N4 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | [3-(difluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanamine |
| SMILES | NCC1CCc2nnc(C(F)F)n2C1 |
| InChI | InChI=1S/C8H12F2N4/c9-7(10)8-13-12-6-2-1-5(3-11)4-14(6)8/h5,7H,1-4,11H2 |
| InChIKey | TVXXXCINSMRGOP-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |