About 5-fluoro-4-methyl-1,3-thiazol-2-amine;hydrochloride
5-fluoro-4-methyl-1,3-thiazol-2-amine;hydrochloride (PubChem CID 71757840) has the molecular formula C4H6ClFN2S
and a molecular weight of 168.62 g/mol. Its IUPAC name is 5-fluoro-4-methyl-1,3-thiazol-2-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-fluoro-4-methyl-1,3-thiazol-2-amine;hydrochloride |
| PubChem CID | 71757840 |
| Molecular Formula | C4H6ClFN2S |
| Molecular Weight | 168.62 g/mol |
| Exact Mass | 167.99 |
| IUPAC Name | 5-fluoro-4-methyl-1,3-thiazol-2-amine;hydrochloride |
| SMILES | Cc1nc(N)sc1F.Cl |
| InChI | InChI=1S/C4H5FN2S.ClH/c1-2-3(5)8-4(6)7-2;/h1H3,(H2,6,7);1H |
| InChIKey | DGBSIDBGEVRJDH-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.62 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-fluoro-4-methyl-1,3-thiazol-2-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-4-methyl-1,3-thiazol-2-amine;hydrochloride?
The IUPAC name of 5-fluoro-4-methyl-1,3-thiazol-2-amine;hydrochloride (CID 71757840) is 5-fluoro-4-methyl-1,3-thiazol-2-amine;hydrochloride.
What is the SMILES notation for 5-fluoro-4-methyl-1,3-thiazol-2-amine;hydrochloride?
The canonical SMILES for 5-fluoro-4-methyl-1,3-thiazol-2-amine;hydrochloride is Cc1nc(N)sc1F.Cl.
What is the InChIKey of 5-fluoro-4-methyl-1,3-thiazol-2-amine;hydrochloride?
The InChIKey is DGBSIDBGEVRJDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5FN2S.ClH/c1-2-3(5)8-4(6)7-2;/h1H3,(H2,6,7);1H.
What are the key properties of 5-fluoro-4-methyl-1,3-thiazol-2-amine;hydrochloride?
5-fluoro-4-methyl-1,3-thiazol-2-amine;hydrochloride has a molecular weight of 168.62 g/mol, XLogP of 1.59, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-4-methyl-1,3-thiazol-2-amine;hydrochloride is sourced from PubChem (CID 71757840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).