About 4,4,4-trifluorobutanimidamide;hydrochloride
4,4,4-trifluorobutanimidamide;hydrochloride (PubChem CID 71758218) has the molecular formula C4H8ClF3N2
and a molecular weight of 176.57 g/mol. Its IUPAC name is 4,4,4-trifluorobutanimidamide;hydrochloride.
Molecular Properties
| Compound Name | 4,4,4-trifluorobutanimidamide;hydrochloride |
| PubChem CID | 71758218 |
| Molecular Formula | C4H8ClF3N2 |
| Molecular Weight | 176.57 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | 4,4,4-trifluorobutanimidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)CCC(F)(F)F |
| InChI | InChI=1S/C4H7F3N2.ClH/c5-4(6,7)2-1-3(8)9;/h1-2H2,(H3,8,9);1H |
| InChIKey | RZDZYIZVZIWNEC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.57 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4,4,4-trifluorobutanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4,4-trifluorobutanimidamide;hydrochloride?
The IUPAC name of 4,4,4-trifluorobutanimidamide;hydrochloride (CID 71758218) is 4,4,4-trifluorobutanimidamide;hydrochloride.
What is the SMILES notation for 4,4,4-trifluorobutanimidamide;hydrochloride?
The canonical SMILES for 4,4,4-trifluorobutanimidamide;hydrochloride is Cl.[H]/N=C(\N)CCC(F)(F)F.
What is the InChIKey of 4,4,4-trifluorobutanimidamide;hydrochloride?
The InChIKey is RZDZYIZVZIWNEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7F3N2.ClH/c5-4(6,7)2-1-3(8)9;/h1-2H2,(H3,8,9);1H.
What are the key properties of 4,4,4-trifluorobutanimidamide;hydrochloride?
4,4,4-trifluorobutanimidamide;hydrochloride has a molecular weight of 176.57 g/mol, XLogP of 1.69, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4,4-trifluorobutanimidamide;hydrochloride is sourced from PubChem (CID 71758218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).