About (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride
(4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride (PubChem CID 71758273) has the molecular formula C7H14Cl2N4
and a molecular weight of 225.12 g/mol. Its IUPAC name is (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride.
Molecular Properties
| Compound Name | (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride |
| PubChem CID | 71758273 |
| Molecular Formula | C7H14Cl2N4 |
| Molecular Weight | 225.12 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride |
| SMILES | Cc1nnc(CN)n1C1CC1.Cl.Cl |
| InChI | InChI=1S/C7H12N4.2ClH/c1-5-9-10-7(4-8)11(5)6-2-3-6;;/h6H,2-4,8H2,1H3;2*1H |
| InChIKey | SBOYCGKHAKGMHB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.12 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride?
The IUPAC name of (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride (CID 71758273) is (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride.
What is the SMILES notation for (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride?
The canonical SMILES for (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride is Cc1nnc(CN)n1C1CC1.Cl.Cl.
What is the InChIKey of (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride?
The InChIKey is SBOYCGKHAKGMHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4.2ClH/c1-5-9-10-7(4-8)11(5)6-2-3-6;;/h6H,2-4,8H2,1H3;2*1H.
What are the key properties of (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride?
(4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride has a molecular weight of 225.12 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methanamine;dihydrochloride is sourced from PubChem (CID 71758273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).