About (1S)-1-(1,3-thiazol-5-yl)ethanol;hydrochloride
(1S)-1-(1,3-thiazol-5-yl)ethanol;hydrochloride (PubChem CID 71758291) has the molecular formula C5H8ClNOS
and a molecular weight of 165.65 g/mol. Its IUPAC name is (1S)-1-(1,3-thiazol-5-yl)ethanol;hydrochloride.
Molecular Properties
| Compound Name | (1S)-1-(1,3-thiazol-5-yl)ethanol;hydrochloride |
| PubChem CID | 71758291 |
| Molecular Formula | C5H8ClNOS |
| Molecular Weight | 165.65 g/mol |
| Exact Mass | 165.00 |
| IUPAC Name | (1S)-1-(1,3-thiazol-5-yl)ethanol;hydrochloride |
| SMILES | C[C@H](O)c1cncs1.Cl |
| InChI | InChI=1S/C5H7NOS.ClH/c1-4(7)5-2-6-3-8-5;/h2-4,7H,1H3;1H/t4-;/m0./s1 |
| InChIKey | XXGJSNMDNXPFLR-WCCKRBBISA-N |
| XLogP | 1.62 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.65 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S)-1-(1,3-thiazol-5-yl)ethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(1,3-thiazol-5-yl)ethanol;hydrochloride?
The IUPAC name of (1S)-1-(1,3-thiazol-5-yl)ethanol;hydrochloride (CID 71758291) is (1S)-1-(1,3-thiazol-5-yl)ethanol;hydrochloride.
What is the SMILES notation for (1S)-1-(1,3-thiazol-5-yl)ethanol;hydrochloride?
The canonical SMILES for (1S)-1-(1,3-thiazol-5-yl)ethanol;hydrochloride is C[C@H](O)c1cncs1.Cl.
What is the InChIKey of (1S)-1-(1,3-thiazol-5-yl)ethanol;hydrochloride?
The InChIKey is XXGJSNMDNXPFLR-WCCKRBBISA-N. The full InChI is InChI=1S/C5H7NOS.ClH/c1-4(7)5-2-6-3-8-5;/h2-4,7H,1H3;1H/t4-;/m0./s1.
What are the key properties of (1S)-1-(1,3-thiazol-5-yl)ethanol;hydrochloride?
(1S)-1-(1,3-thiazol-5-yl)ethanol;hydrochloride has a molecular weight of 165.65 g/mol, XLogP of 1.62, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(1,3-thiazol-5-yl)ethanol;hydrochloride is sourced from PubChem (CID 71758291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).