About N-methyl-N-(2,2,2-trifluoroethyl)piperidin-4-amine;hydrochloride
N-methyl-N-(2,2,2-trifluoroethyl)piperidin-4-amine;hydrochloride (PubChem CID 71758336) has the molecular formula C8H16ClF3N2
and a molecular weight of 232.68 g/mol. Its IUPAC name is N-methyl-N-(2,2,2-trifluoroethyl)piperidin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | N-methyl-N-(2,2,2-trifluoroethyl)piperidin-4-amine;hydrochloride |
| PubChem CID | 71758336 |
| Molecular Formula | C8H16ClF3N2 |
| Molecular Weight | 232.68 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | N-methyl-N-(2,2,2-trifluoroethyl)piperidin-4-amine;hydrochloride |
| SMILES | CN(CC(F)(F)F)C1CCNCC1.Cl |
| InChI | InChI=1S/C8H15F3N2.ClH/c1-13(6-8(9,10)11)7-2-4-12-5-3-7;/h7,12H,2-6H2,1H3;1H |
| InChIKey | TVQIGGRIQQXJDU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.68 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-methyl-N-(2,2,2-trifluoroethyl)piperidin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-(2,2,2-trifluoroethyl)piperidin-4-amine;hydrochloride?
The IUPAC name of N-methyl-N-(2,2,2-trifluoroethyl)piperidin-4-amine;hydrochloride (CID 71758336) is N-methyl-N-(2,2,2-trifluoroethyl)piperidin-4-amine;hydrochloride.
What is the SMILES notation for N-methyl-N-(2,2,2-trifluoroethyl)piperidin-4-amine;hydrochloride?
The canonical SMILES for N-methyl-N-(2,2,2-trifluoroethyl)piperidin-4-amine;hydrochloride is CN(CC(F)(F)F)C1CCNCC1.Cl.
What is the InChIKey of N-methyl-N-(2,2,2-trifluoroethyl)piperidin-4-amine;hydrochloride?
The InChIKey is TVQIGGRIQQXJDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F3N2.ClH/c1-13(6-8(9,10)11)7-2-4-12-5-3-7;/h7,12H,2-6H2,1H3;1H.
What are the key properties of N-methyl-N-(2,2,2-trifluoroethyl)piperidin-4-amine;hydrochloride?
N-methyl-N-(2,2,2-trifluoroethyl)piperidin-4-amine;hydrochloride has a molecular weight of 232.68 g/mol, XLogP of 1.65, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-(2,2,2-trifluoroethyl)piperidin-4-amine;hydrochloride is sourced from PubChem (CID 71758336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).