About 5-(chloromethyl)-3-ethyl-1H-1,2,4-triazole;hydrochloride
5-(chloromethyl)-3-ethyl-1H-1,2,4-triazole;hydrochloride (PubChem CID 71758430) has the molecular formula C5H9Cl2N3
and a molecular weight of 182.05 g/mol. Its IUPAC name is 5-(chloromethyl)-3-ethyl-1H-1,2,4-triazole;hydrochloride.
Molecular Properties
| Compound Name | 5-(chloromethyl)-3-ethyl-1H-1,2,4-triazole;hydrochloride |
| PubChem CID | 71758430 |
| Molecular Formula | C5H9Cl2N3 |
| Molecular Weight | 182.05 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 5-(chloromethyl)-3-ethyl-1H-1,2,4-triazole;hydrochloride |
| SMILES | CCc1n[nH]c(CCl)n1.Cl |
| InChI | InChI=1S/C5H8ClN3.ClH/c1-2-4-7-5(3-6)9-8-4;/h2-3H2,1H3,(H,7,8,9);1H |
| InChIKey | BVBQLKISRUCRQA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.05 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(chloromethyl)-3-ethyl-1H-1,2,4-triazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(chloromethyl)-3-ethyl-1H-1,2,4-triazole;hydrochloride?
The IUPAC name of 5-(chloromethyl)-3-ethyl-1H-1,2,4-triazole;hydrochloride (CID 71758430) is 5-(chloromethyl)-3-ethyl-1H-1,2,4-triazole;hydrochloride.
What is the SMILES notation for 5-(chloromethyl)-3-ethyl-1H-1,2,4-triazole;hydrochloride?
The canonical SMILES for 5-(chloromethyl)-3-ethyl-1H-1,2,4-triazole;hydrochloride is CCc1n[nH]c(CCl)n1.Cl.
What is the InChIKey of 5-(chloromethyl)-3-ethyl-1H-1,2,4-triazole;hydrochloride?
The InChIKey is BVBQLKISRUCRQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8ClN3.ClH/c1-2-4-7-5(3-6)9-8-4;/h2-3H2,1H3,(H,7,8,9);1H.
What are the key properties of 5-(chloromethyl)-3-ethyl-1H-1,2,4-triazole;hydrochloride?
5-(chloromethyl)-3-ethyl-1H-1,2,4-triazole;hydrochloride has a molecular weight of 182.05 g/mol, XLogP of 1.53, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(chloromethyl)-3-ethyl-1H-1,2,4-triazole;hydrochloride is sourced from PubChem (CID 71758430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).