About 1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine;dihydrochloride
1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine;dihydrochloride (PubChem CID 71758438) has the molecular formula C6H13Cl2N3S
and a molecular weight of 230.16 g/mol. Its IUPAC name is 1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine;dihydrochloride |
| PubChem CID | 71758438 |
| Molecular Formula | C6H13Cl2N3S |
| Molecular Weight | 230.16 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | 1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine;dihydrochloride |
| SMILES | Cc1nc(C(N)CN)cs1.Cl.Cl |
| InChI | InChI=1S/C6H11N3S.2ClH/c1-4-9-6(3-10-4)5(8)2-7;;/h3,5H,2,7-8H2,1H3;2*1H |
| InChIKey | VAUDLEUZCFRTBV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.16 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine;dihydrochloride?
The IUPAC name of 1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine;dihydrochloride (CID 71758438) is 1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine;dihydrochloride.
What is the SMILES notation for 1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine;dihydrochloride?
The canonical SMILES for 1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine;dihydrochloride is Cc1nc(C(N)CN)cs1.Cl.Cl.
What is the InChIKey of 1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine;dihydrochloride?
The InChIKey is VAUDLEUZCFRTBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3S.2ClH/c1-4-9-6(3-10-4)5(8)2-7;;/h3,5H,2,7-8H2,1H3;2*1H.
What are the key properties of 1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine;dihydrochloride?
1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine;dihydrochloride has a molecular weight of 230.16 g/mol, XLogP of 1.25, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methyl-1,3-thiazol-4-yl)ethane-1,2-diamine;dihydrochloride is sourced from PubChem (CID 71758438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).