C11H16N2O — CID 71758454
4-ethoxy-5,6,7,8-tetrahydroquinolin-8-amine (PubChem CID 71758454) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 4-ethoxy-5,6,7,8-tetrahydroquinolin-8-amine.
| Compound Name | 4-ethoxy-5,6,7,8-tetrahydroquinolin-8-amine |
|---|---|
| PubChem CID | 71758454 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 4-ethoxy-5,6,7,8-tetrahydroquinolin-8-amine |
| SMILES | CCOc1ccnc2c1CCCC2N |
| InChI | InChI=1S/C11H16N2O/c1-2-14-10-6-7-13-11-8(10)4-3-5-9(11)12/h6-7,9H,2-5,12H2,1H3 |
| InChIKey | HXRVJXAEXROYCL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |