About 2-amino-4-methyl-1,3-thiazole-5-carbonitrile;hydrochloride
2-amino-4-methyl-1,3-thiazole-5-carbonitrile;hydrochloride (PubChem CID 71758598) has the molecular formula C5H6ClN3S
and a molecular weight of 175.64 g/mol. Its IUPAC name is 2-amino-4-methyl-1,3-thiazole-5-carbonitrile;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-4-methyl-1,3-thiazole-5-carbonitrile;hydrochloride |
| PubChem CID | 71758598 |
| Molecular Formula | C5H6ClN3S |
| Molecular Weight | 175.64 g/mol |
| Exact Mass | 175.00 |
| IUPAC Name | 2-amino-4-methyl-1,3-thiazole-5-carbonitrile;hydrochloride |
| SMILES | Cc1nc(N)sc1C#N.Cl |
| InChI | InChI=1S/C5H5N3S.ClH/c1-3-4(2-6)9-5(7)8-3;/h1H3,(H2,7,8);1H |
| InChIKey | MXFCFXQFRNMFJA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.64 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-4-methyl-1,3-thiazole-5-carbonitrile;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-methyl-1,3-thiazole-5-carbonitrile;hydrochloride?
The IUPAC name of 2-amino-4-methyl-1,3-thiazole-5-carbonitrile;hydrochloride (CID 71758598) is 2-amino-4-methyl-1,3-thiazole-5-carbonitrile;hydrochloride.
What is the SMILES notation for 2-amino-4-methyl-1,3-thiazole-5-carbonitrile;hydrochloride?
The canonical SMILES for 2-amino-4-methyl-1,3-thiazole-5-carbonitrile;hydrochloride is Cc1nc(N)sc1C#N.Cl.
What is the InChIKey of 2-amino-4-methyl-1,3-thiazole-5-carbonitrile;hydrochloride?
The InChIKey is MXFCFXQFRNMFJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3S.ClH/c1-3-4(2-6)9-5(7)8-3;/h1H3,(H2,7,8);1H.
What are the key properties of 2-amino-4-methyl-1,3-thiazole-5-carbonitrile;hydrochloride?
2-amino-4-methyl-1,3-thiazole-5-carbonitrile;hydrochloride has a molecular weight of 175.64 g/mol, XLogP of 1.33, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-methyl-1,3-thiazole-5-carbonitrile;hydrochloride is sourced from PubChem (CID 71758598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).