About 5-methyl-4,5-dihydro-1H-imidazol-2-amine;hydrobromide
5-methyl-4,5-dihydro-1H-imidazol-2-amine;hydrobromide (PubChem CID 71758637) has the molecular formula C4H10BrN3
and a molecular weight of 180.05 g/mol. Its IUPAC name is 5-methyl-4,5-dihydro-1H-imidazol-2-amine;hydrobromide.
Molecular Properties
| Compound Name | 5-methyl-4,5-dihydro-1H-imidazol-2-amine;hydrobromide |
| PubChem CID | 71758637 |
| Molecular Formula | C4H10BrN3 |
| Molecular Weight | 180.05 g/mol |
| Exact Mass | 179.01 |
| IUPAC Name | 5-methyl-4,5-dihydro-1H-imidazol-2-amine;hydrobromide |
| SMILES | Br.CC1CN=C(N)N1 |
| InChI | InChI=1S/C4H9N3.BrH/c1-3-2-6-4(5)7-3;/h3H,2H2,1H3,(H3,5,6,7);1H |
| InChIKey | PHIXMNQKPSILHJ-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.05 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-4,5-dihydro-1H-imidazol-2-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4,5-dihydro-1H-imidazol-2-amine;hydrobromide?
The IUPAC name of 5-methyl-4,5-dihydro-1H-imidazol-2-amine;hydrobromide (CID 71758637) is 5-methyl-4,5-dihydro-1H-imidazol-2-amine;hydrobromide.
What is the SMILES notation for 5-methyl-4,5-dihydro-1H-imidazol-2-amine;hydrobromide?
The canonical SMILES for 5-methyl-4,5-dihydro-1H-imidazol-2-amine;hydrobromide is Br.CC1CN=C(N)N1.
What is the InChIKey of 5-methyl-4,5-dihydro-1H-imidazol-2-amine;hydrobromide?
The InChIKey is PHIXMNQKPSILHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N3.BrH/c1-3-2-6-4(5)7-3;/h3H,2H2,1H3,(H3,5,6,7);1H.
What are the key properties of 5-methyl-4,5-dihydro-1H-imidazol-2-amine;hydrobromide?
5-methyl-4,5-dihydro-1H-imidazol-2-amine;hydrobromide has a molecular weight of 180.05 g/mol, XLogP of -0.13, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4,5-dihydro-1H-imidazol-2-amine;hydrobromide is sourced from PubChem (CID 71758637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).