About 4-(aminomethyl)-3,4-dihydro-1H-quinolin-2-one
4-(aminomethyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 71758744) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 4-(aminomethyl)-3,4-dihydro-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 4-(aminomethyl)-3,4-dihydro-1H-quinolin-2-one |
| PubChem CID | 71758744 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 4-(aminomethyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | NCC1CC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C10H12N2O/c11-6-7-5-10(13)12-9-4-2-1-3-8(7)9/h1-4,7H,5-6,11H2,(H,12,13) |
| InChIKey | ZJMZHOMUFKQBLT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(aminomethyl)-3,4-dihydro-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-3,4-dihydro-1H-quinolin-2-one?
The IUPAC name of 4-(aminomethyl)-3,4-dihydro-1H-quinolin-2-one (CID 71758744) is 4-(aminomethyl)-3,4-dihydro-1H-quinolin-2-one.
What is the SMILES notation for 4-(aminomethyl)-3,4-dihydro-1H-quinolin-2-one?
The canonical SMILES for 4-(aminomethyl)-3,4-dihydro-1H-quinolin-2-one is NCC1CC(=O)Nc2ccccc21.
What is the InChIKey of 4-(aminomethyl)-3,4-dihydro-1H-quinolin-2-one?
The InChIKey is ZJMZHOMUFKQBLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c11-6-7-5-10(13)12-9-4-2-1-3-8(7)9/h1-4,7H,5-6,11H2,(H,12,13).
What are the key properties of 4-(aminomethyl)-3,4-dihydro-1H-quinolin-2-one?
4-(aminomethyl)-3,4-dihydro-1H-quinolin-2-one has a molecular weight of 176.22 g/mol, XLogP of 1.07, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-3,4-dihydro-1H-quinolin-2-one is sourced from PubChem (CID 71758744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).