C12H20N2O2 — CID 71758870
(7R,9Z)-7-ethyl-1,6-diazacyclododec-9-ene-2,5-dione (PubChem CID 71758870) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is (7R,9Z)-7-ethyl-1,6-diazacyclododec-9-ene-2,5-dione.
| Compound Name | (7R,9Z)-7-ethyl-1,6-diazacyclododec-9-ene-2,5-dione |
|---|---|
| PubChem CID | 71758870 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | (7R,9Z)-7-ethyl-1,6-diazacyclododec-9-ene-2,5-dione |
| SMILES | CC[C@@H]1C/C=C\CCNC(=O)CCC(=O)N1 |
| InChI | InChI=1S/C12H20N2O2/c1-2-10-6-4-3-5-9-13-11(15)7-8-12(16)14-10/h3-4,10H,2,5-9H2,1H3,(H,13,15)(H,14,16)/b4-3-/t10-/m1/s1 |
| InChIKey | GFSGVEMMBIHCBJ-UMBAGQNISA-N |
| XLogP | 1.13 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|