C23H34N2O3 — CID 71758907
(3R,5E,8R,11R)-3,12-dimethyl-8,11-di(propan-2-yl)-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione (PubChem CID 71758907) has the molecular formula C23H34N2O3 and a molecular weight of 386.54 g/mol. Its IUPAC name is (3R,5E,8R,11R)-3,12-dimethyl-8,11-di(propan-2-yl)-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione.
| Compound Name | (3R,5E,8R,11R)-3,12-dimethyl-8,11-di(propan-2-yl)-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione |
|---|---|
| PubChem CID | 71758907 |
| Molecular Formula | C23H34N2O3 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | (3R,5E,8R,11R)-3,12-dimethyl-8,11-di(propan-2-yl)-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione |
| SMILES | CC(C)[C@H]1C/C=C/C[C@@H](C)Oc2ccccc2C(=O)N(C)[C@H](C(C)C)C(=O)N1 |
| InChI | InChI=1S/C23H34N2O3/c1-15(2)19-13-9-7-11-17(5)28-20-14-10-8-12-18(20)23(27)25(6)21(16(3)4)22(26)24-19/h7-10,12,14-17,19,21H,11,13H2,1-6H3,(H,24,26)/b9-7+/t17-,19-,21-/m1/s1 |
| InChIKey | LWHPZOYAMURLFL-DJTUWZQVSA-N |
| XLogP | 4.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|