C20H31N3O4 — CID 71758934
tert-butyl N-[[(2S,3R)-9-amino-3,5-dimethyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-2-yl]methyl]-N-methylcarbamate (PubChem CID 71758934) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is tert-butyl N-[[(2S,3R)-9-amino-3,5-dimethyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-2-yl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[(2S,3R)-9-amino-3,5-dimethyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-2-yl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 71758934 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | tert-butyl N-[[(2S,3R)-9-amino-3,5-dimethyl-6-oxo-2,3,4,7-tetrahydro-1,5-benzoxazonin-2-yl]methyl]-N-methylcarbamate |
| SMILES | C[C@@H]1CN(C)C(=O)Cc2cc(N)ccc2O[C@@H]1CN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H31N3O4/c1-13-11-22(5)18(24)10-14-9-15(21)7-8-16(14)26-17(13)12-23(6)19(25)27-20(2,3)4/h7-9,13,17H,10-12,21H2,1-6H3/t13-,17-/m1/s1 |
| InChIKey | FKVAGPIVUGMOCL-CXAGYDPISA-N |
| XLogP | 2.53 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|