C28H36N2O5 — CID 71758946
(3S,5E,8R,11S)-8-(2,4-dimethoxyphenyl)-3,12-dimethyl-11-propan-2-yl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione (PubChem CID 71758946) has the molecular formula C28H36N2O5 and a molecular weight of 480.61 g/mol. Its IUPAC name is (3S,5E,8R,11S)-8-(2,4-dimethoxyphenyl)-3,12-dimethyl-11-propan-2-yl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione.
| Compound Name | (3S,5E,8R,11S)-8-(2,4-dimethoxyphenyl)-3,12-dimethyl-11-propan-2-yl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione |
|---|---|
| PubChem CID | 71758946 |
| Molecular Formula | C28H36N2O5 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | (3S,5E,8R,11S)-8-(2,4-dimethoxyphenyl)-3,12-dimethyl-11-propan-2-yl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione |
| SMILES | COc1ccc([C@H]2C/C=C/C[C@H](C)Oc3ccccc3C(=O)N(C)[C@@H](C(C)C)C(=O)N2)c(OC)c1 |
| InChI | InChI=1S/C28H36N2O5/c1-18(2)26-27(31)29-23(21-16-15-20(33-5)17-25(21)34-6)13-9-7-11-19(3)35-24-14-10-8-12-22(24)28(32)30(26)4/h7-10,12,14-19,23,26H,11,13H2,1-6H3,(H,29,31)/b9-7+/t19-,23+,26-/m0/s1 |
| InChIKey | BFWSPGRNJVUHOI-VJGXJJJDSA-N |
| XLogP | 4.78 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|