C26H32N2O5 — CID 71759304
(3S,5Z,8R,11R)-8-(2,4-dimethoxyphenyl)-3,11,12-trimethyl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione (PubChem CID 71759304) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is (3S,5Z,8R,11R)-8-(2,4-dimethoxyphenyl)-3,11,12-trimethyl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione.
| Compound Name | (3S,5Z,8R,11R)-8-(2,4-dimethoxyphenyl)-3,11,12-trimethyl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione |
|---|---|
| PubChem CID | 71759304 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | (3S,5Z,8R,11R)-8-(2,4-dimethoxyphenyl)-3,11,12-trimethyl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione |
| SMILES | COc1ccc([C@H]2C/C=C\C[C@H](C)Oc3ccccc3C(=O)N(C)[C@H](C)C(=O)N2)c(OC)c1 |
| InChI | InChI=1S/C26H32N2O5/c1-17-10-6-8-12-22(20-15-14-19(31-4)16-24(20)32-5)27-25(29)18(2)28(3)26(30)21-11-7-9-13-23(21)33-17/h6-9,11,13-18,22H,10,12H2,1-5H3,(H,27,29)/b8-6-/t17-,18+,22+/m0/s1 |
| InChIKey | PLLQGFFROYVUEK-QNXYNWSFSA-N |
| XLogP | 4.14 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|