C31H32N2O5 — CID 71759316
(3S,5E,8R,11R)-8-(1,3-benzodioxol-5-yl)-11-benzyl-3,12-dimethyl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione (PubChem CID 71759316) has the molecular formula C31H32N2O5 and a molecular weight of 512.61 g/mol. Its IUPAC name is (3S,5E,8R,11R)-8-(1,3-benzodioxol-5-yl)-11-benzyl-3,12-dimethyl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione.
| Compound Name | (3S,5E,8R,11R)-8-(1,3-benzodioxol-5-yl)-11-benzyl-3,12-dimethyl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione |
|---|---|
| PubChem CID | 71759316 |
| Molecular Formula | C31H32N2O5 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | (3S,5E,8R,11R)-8-(1,3-benzodioxol-5-yl)-11-benzyl-3,12-dimethyl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione |
| SMILES | C[C@H]1C/C=C/C[C@H](c2ccc3c(c2)OCO3)NC(=O)[C@@H](Cc2ccccc2)N(C)C(=O)c2ccccc2O1 |
| InChI | InChI=1S/C31H32N2O5/c1-21-10-6-8-14-25(23-16-17-28-29(19-23)37-20-36-28)32-30(34)26(18-22-11-4-3-5-12-22)33(2)31(35)24-13-7-9-15-27(24)38-21/h3-9,11-13,15-17,19,21,25-26H,10,14,18,20H2,1-2H3,(H,32,34)/b8-6+/t21-,25+,26+/m0/s1 |
| InChIKey | PKGGRPDYQUVPQM-TXNJPPGHSA-N |
| XLogP | 5.07 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|