C26H31ClN2O3 — CID 71759380
(3R,5E,8S,11S)-8-(3-chlorophenyl)-3,12-dimethyl-11-propan-2-yl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione (PubChem CID 71759380) has the molecular formula C26H31ClN2O3 and a molecular weight of 455.00 g/mol. Its IUPAC name is (3R,5E,8S,11S)-8-(3-chlorophenyl)-3,12-dimethyl-11-propan-2-yl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione.
| Compound Name | (3R,5E,8S,11S)-8-(3-chlorophenyl)-3,12-dimethyl-11-propan-2-yl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione |
|---|---|
| PubChem CID | 71759380 |
| Molecular Formula | C26H31ClN2O3 |
| Molecular Weight | 455.00 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | (3R,5E,8S,11S)-8-(3-chlorophenyl)-3,12-dimethyl-11-propan-2-yl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione |
| SMILES | CC(C)[C@H]1C(=O)N[C@H](c2cccc(Cl)c2)C/C=C/C[C@@H](C)Oc2ccccc2C(=O)N1C |
| InChI | InChI=1S/C26H31ClN2O3/c1-17(2)24-25(30)28-22(19-11-9-12-20(27)16-19)14-7-5-10-18(3)32-23-15-8-6-13-21(23)26(31)29(24)4/h5-9,11-13,15-18,22,24H,10,14H2,1-4H3,(H,28,30)/b7-5+/t18-,22+,24+/m1/s1 |
| InChIKey | WWYMTBAGGGOWPA-VMFVWQGRSA-N |
| XLogP | 5.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.00 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|