C21H30N2O3 — CID 71759458
(3R,5Z,8S,11R)-3,11,12-trimethyl-8-propan-2-yl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione (PubChem CID 71759458) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is (3R,5Z,8S,11R)-3,11,12-trimethyl-8-propan-2-yl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione.
| Compound Name | (3R,5Z,8S,11R)-3,11,12-trimethyl-8-propan-2-yl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione |
|---|---|
| PubChem CID | 71759458 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | (3R,5Z,8S,11R)-3,11,12-trimethyl-8-propan-2-yl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione |
| SMILES | CC(C)[C@@H]1C/C=C\C[C@@H](C)Oc2ccccc2C(=O)N(C)[C@H](C)C(=O)N1 |
| InChI | InChI=1S/C21H30N2O3/c1-14(2)18-12-8-6-10-15(3)26-19-13-9-7-11-17(19)21(25)23(5)16(4)20(24)22-18/h6-9,11,13-16,18H,10,12H2,1-5H3,(H,22,24)/b8-6-/t15-,16-,18+/m1/s1 |
| InChIKey | QFIUZUGIFYOZOV-WRDCTRJWSA-N |
| XLogP | 3.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|