C30H31FN2O3 — CID 71759758
(3S,5E,8R,11S)-11-benzyl-8-(4-fluorophenyl)-3,12-dimethyl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione (PubChem CID 71759758) has the molecular formula C30H31FN2O3 and a molecular weight of 486.59 g/mol. Its IUPAC name is (3S,5E,8R,11S)-11-benzyl-8-(4-fluorophenyl)-3,12-dimethyl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione.
| Compound Name | (3S,5E,8R,11S)-11-benzyl-8-(4-fluorophenyl)-3,12-dimethyl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione |
|---|---|
| PubChem CID | 71759758 |
| Molecular Formula | C30H31FN2O3 |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | (3S,5E,8R,11S)-11-benzyl-8-(4-fluorophenyl)-3,12-dimethyl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione |
| SMILES | C[C@H]1C/C=C/C[C@H](c2ccc(F)cc2)NC(=O)[C@H](Cc2ccccc2)N(C)C(=O)c2ccccc2O1 |
| InChI | InChI=1S/C30H31FN2O3/c1-21-10-6-8-14-26(23-16-18-24(31)19-17-23)32-29(34)27(20-22-11-4-3-5-12-22)33(2)30(35)25-13-7-9-15-28(25)36-21/h3-9,11-13,15-19,21,26-27H,10,14,20H2,1-2H3,(H,32,34)/b8-6+/t21-,26+,27-/m0/s1 |
| InChIKey | CFWHYHIEKGYMFZ-XXRUCCMWSA-N |
| XLogP | 5.48 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|