C10H22N4 — CID 7176005
2-(2,2,6,6-tetramethylpiperidin-4-yl)guanidine (PubChem CID 7176005) has the molecular formula C10H22N4 and a molecular weight of 198.31 g/mol. Its IUPAC name is 2-(2,2,6,6-tetramethylpiperidin-4-yl)guanidine.
| Compound Name | 2-(2,2,6,6-tetramethylpiperidin-4-yl)guanidine |
|---|---|
| PubChem CID | 7176005 |
| Molecular Formula | C10H22N4 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | 2-(2,2,6,6-tetramethylpiperidin-4-yl)guanidine |
| SMILES | CC1(C)CC(N=C(N)N)CC(C)(C)N1 |
| InChI | InChI=1S/C10H22N4/c1-9(2)5-7(13-8(11)12)6-10(3,4)14-9/h7,14H,5-6H2,1-4H3,(H4,11,12,13) |
| InChIKey | AYLPVOFHYZCDCJ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|