C24H27FN2O2 — CID 71760232
1-[(3aR,4S,9bS)-8-(4-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-2-cyclopropylethanone (PubChem CID 71760232) has the molecular formula C24H27FN2O2 and a molecular weight of 394.49 g/mol. Its IUPAC name is 1-[(3aR,4S,9bS)-8-(4-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-2-cyclopropylethanone.
| Compound Name | 1-[(3aR,4S,9bS)-8-(4-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-2-cyclopropylethanone |
|---|---|
| PubChem CID | 71760232 |
| Molecular Formula | C24H27FN2O2 |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 1-[(3aR,4S,9bS)-8-(4-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-2-cyclopropylethanone |
| SMILES | CN1c2ccc(-c3ccc(F)cc3)cc2[C@@H]2[C@@H](CCN2C(=O)CC2CC2)[C@H]1CO |
| InChI | InChI=1S/C24H27FN2O2/c1-26-21-9-6-17(16-4-7-18(25)8-5-16)13-20(21)24-19(22(26)14-28)10-11-27(24)23(29)12-15-2-3-15/h4-9,13,15,19,22,24,28H,2-3,10-12,14H2,1H3/t19-,22+,24-/m0/s1 |
| InChIKey | MRQNFXNAYHWIEE-KWOQKUFVSA-N |
| XLogP | 3.99 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |