C24H27ClN2O3 — CID 71760283
(3R,5E,8R,11S)-8-(3-chlorophenyl)-3,11,12-trimethyl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione (PubChem CID 71760283) has the molecular formula C24H27ClN2O3 and a molecular weight of 426.94 g/mol. Its IUPAC name is (3R,5E,8R,11S)-8-(3-chlorophenyl)-3,11,12-trimethyl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione.
| Compound Name | (3R,5E,8R,11S)-8-(3-chlorophenyl)-3,11,12-trimethyl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione |
|---|---|
| PubChem CID | 71760283 |
| Molecular Formula | C24H27ClN2O3 |
| Molecular Weight | 426.94 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | (3R,5E,8R,11S)-8-(3-chlorophenyl)-3,11,12-trimethyl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione |
| SMILES | C[C@@H]1C/C=C/C[C@H](c2cccc(Cl)c2)NC(=O)[C@H](C)N(C)C(=O)c2ccccc2O1 |
| InChI | InChI=1S/C24H27ClN2O3/c1-16-9-4-6-13-21(18-10-8-11-19(25)15-18)26-23(28)17(2)27(3)24(29)20-12-5-7-14-22(20)30-16/h4-8,10-12,14-17,21H,9,13H2,1-3H3,(H,26,28)/b6-4+/t16-,17+,21-/m1/s1 |
| InChIKey | PYMAUDDQBOVGEE-STWANLKKSA-N |
| XLogP | 4.78 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.94 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|