C14H24N2O2 — CID 71760544
(3R,7R,9Z)-3-methyl-7-propan-2-yl-1,6-diazacyclododec-9-ene-2,5-dione (PubChem CID 71760544) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is (3R,7R,9Z)-3-methyl-7-propan-2-yl-1,6-diazacyclododec-9-ene-2,5-dione.
| Compound Name | (3R,7R,9Z)-3-methyl-7-propan-2-yl-1,6-diazacyclododec-9-ene-2,5-dione |
|---|---|
| PubChem CID | 71760544 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | (3R,7R,9Z)-3-methyl-7-propan-2-yl-1,6-diazacyclododec-9-ene-2,5-dione |
| SMILES | CC(C)[C@H]1C/C=C\CCNC(=O)[C@H](C)CC(=O)N1 |
| InChI | InChI=1S/C14H24N2O2/c1-10(2)12-7-5-4-6-8-15-14(18)11(3)9-13(17)16-12/h4-5,10-12H,6-9H2,1-3H3,(H,15,18)(H,16,17)/b5-4-/t11-,12-/m1/s1 |
| InChIKey | VHPXHVMQYGDAQE-XLMCQVRKSA-N |
| XLogP | 1.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|