C24H28N2O3 — CID 71760585
(3R,5Z,8R,11S)-3,11,12-trimethyl-8-phenyl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione (PubChem CID 71760585) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is (3R,5Z,8R,11S)-3,11,12-trimethyl-8-phenyl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione.
| Compound Name | (3R,5Z,8R,11S)-3,11,12-trimethyl-8-phenyl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione |
|---|---|
| PubChem CID | 71760585 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (3R,5Z,8R,11S)-3,11,12-trimethyl-8-phenyl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione |
| SMILES | C[C@@H]1C/C=C\C[C@H](c2ccccc2)NC(=O)[C@H](C)N(C)C(=O)c2ccccc2O1 |
| InChI | InChI=1S/C24H28N2O3/c1-17-11-7-9-15-21(19-12-5-4-6-13-19)25-23(27)18(2)26(3)24(28)20-14-8-10-16-22(20)29-17/h4-10,12-14,16-18,21H,11,15H2,1-3H3,(H,25,27)/b9-7-/t17-,18+,21-/m1/s1 |
| InChIKey | AFJZYKXXKFYJLB-LXEZEIDTSA-N |
| XLogP | 4.12 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|