C32H36N2O5 — CID 71760587
(3S,5E,8R,11S)-11-benzyl-8-(2,4-dimethoxyphenyl)-3,12-dimethyl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione (PubChem CID 71760587) has the molecular formula C32H36N2O5 and a molecular weight of 528.65 g/mol. Its IUPAC name is (3S,5E,8R,11S)-11-benzyl-8-(2,4-dimethoxyphenyl)-3,12-dimethyl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione.
| Compound Name | (3S,5E,8R,11S)-11-benzyl-8-(2,4-dimethoxyphenyl)-3,12-dimethyl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione |
|---|---|
| PubChem CID | 71760587 |
| Molecular Formula | C32H36N2O5 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | (3S,5E,8R,11S)-11-benzyl-8-(2,4-dimethoxyphenyl)-3,12-dimethyl-2-oxa-9,12-diazabicyclo[12.4.0]octadeca-1(18),5,14,16-tetraene-10,13-dione |
| SMILES | COc1ccc([C@H]2C/C=C/C[C@H](C)Oc3ccccc3C(=O)N(C)[C@@H](Cc3ccccc3)C(=O)N2)c(OC)c1 |
| InChI | InChI=1S/C32H36N2O5/c1-22-12-8-10-16-27(25-19-18-24(37-3)21-30(25)38-4)33-31(35)28(20-23-13-6-5-7-14-23)34(2)32(36)26-15-9-11-17-29(26)39-22/h5-11,13-15,17-19,21-22,27-28H,12,16,20H2,1-4H3,(H,33,35)/b10-8+/t22-,27+,28-/m0/s1 |
| InChIKey | MNUCZAPCOYCRHX-MMZJXJOHSA-N |
| XLogP | 5.36 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|