About diaminomethylidene-[4-(2-methylphenyl)-1,3-thiazol-2-yl]azanium
diaminomethylidene-[4-(2-methylphenyl)-1,3-thiazol-2-yl]azanium (PubChem CID 7176101) has the molecular formula C11H13N4S+
and a molecular weight of 233.32 g/mol. Its IUPAC name is diaminomethylidene-[4-(2-methylphenyl)-1,3-thiazol-2-yl]azanium.
Molecular Properties
| Compound Name | diaminomethylidene-[4-(2-methylphenyl)-1,3-thiazol-2-yl]azanium |
| PubChem CID | 7176101 |
| Molecular Formula | C11H13N4S+ |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | diaminomethylidene-[4-(2-methylphenyl)-1,3-thiazol-2-yl]azanium |
| SMILES | Cc1ccccc1-c1csc([NH+]=C(N)N)n1 |
| InChI | InChI=1S/C11H12N4S/c1-7-4-2-3-5-8(7)9-6-16-11(14-9)15-10(12)13/h2-6H,1H3,(H4,12,13,14,15)/p+1 |
| InChIKey | LLVXYMYECOBAHK-UHFFFAOYSA-O |
| XLogP | 0.10 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze diaminomethylidene-[4-(2-methylphenyl)-1,3-thiazol-2-yl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diaminomethylidene-[4-(2-methylphenyl)-1,3-thiazol-2-yl]azanium?
The IUPAC name of diaminomethylidene-[4-(2-methylphenyl)-1,3-thiazol-2-yl]azanium (CID 7176101) is diaminomethylidene-[4-(2-methylphenyl)-1,3-thiazol-2-yl]azanium.
What is the SMILES notation for diaminomethylidene-[4-(2-methylphenyl)-1,3-thiazol-2-yl]azanium?
The canonical SMILES for diaminomethylidene-[4-(2-methylphenyl)-1,3-thiazol-2-yl]azanium is Cc1ccccc1-c1csc([NH+]=C(N)N)n1.
What is the InChIKey of diaminomethylidene-[4-(2-methylphenyl)-1,3-thiazol-2-yl]azanium?
The InChIKey is LLVXYMYECOBAHK-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H12N4S/c1-7-4-2-3-5-8(7)9-6-16-11(14-9)15-10(12)13/h2-6H,1H3,(H4,12,13,14,15)/p+1.
What are the key properties of diaminomethylidene-[4-(2-methylphenyl)-1,3-thiazol-2-yl]azanium?
diaminomethylidene-[4-(2-methylphenyl)-1,3-thiazol-2-yl]azanium has a molecular weight of 233.32 g/mol, XLogP of 0.10, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diaminomethylidene-[4-(2-methylphenyl)-1,3-thiazol-2-yl]azanium is sourced from PubChem (CID 7176101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).