C28H33NO4 — CID 71761142
6-[(E)-2-[(7R,8aR,10aR)-7-hydroxy-4-methoxy-8,8,10a-trimethyl-6,7,8a,9-tetrahydro-5H-xanthen-2-yl]ethenyl]-1-methylindol-4-ol (PubChem CID 71761142) has the molecular formula C28H33NO4 and a molecular weight of 447.58 g/mol. Its IUPAC name is 6-[(E)-2-[(7R,8aR,10aR)-7-hydroxy-4-methoxy-8,8,10a-trimethyl-6,7,8a,9-tetrahydro-5H-xanthen-2-yl]ethenyl]-1-methylindol-4-ol.
| Compound Name | 6-[(E)-2-[(7R,8aR,10aR)-7-hydroxy-4-methoxy-8,8,10a-trimethyl-6,7,8a,9-tetrahydro-5H-xanthen-2-yl]ethenyl]-1-methylindol-4-ol |
|---|---|
| PubChem CID | 71761142 |
| Molecular Formula | C28H33NO4 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 6-[(E)-2-[(7R,8aR,10aR)-7-hydroxy-4-methoxy-8,8,10a-trimethyl-6,7,8a,9-tetrahydro-5H-xanthen-2-yl]ethenyl]-1-methylindol-4-ol |
| SMILES | COc1cc(/C=C/c2cc(O)c3ccn(C)c3c2)cc2c1O[C@]1(C)CC[C@@H](O)C(C)(C)[C@H]1C2 |
| InChI | InChI=1S/C28H33NO4/c1-27(2)24-16-19-12-17(6-7-18-13-21-20(22(30)14-18)9-11-29(21)4)15-23(32-5)26(19)33-28(24,3)10-8-25(27)31/h6-7,9,11-15,24-25,30-31H,8,10,16H2,1-5H3/b7-6+/t24-,25-,28-/m1/s1 |
| InChIKey | WFHFGEQWCIRWBB-XFVNFUATSA-N |
| XLogP | 5.55 |
| TPSA | 63.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|