C29H35NO4 — CID 71761143
(2R,4aR,9aR)-5-methoxy-7-[(E)-2-(4-methoxy-1-methylindol-6-yl)ethenyl]-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-xanthen-2-ol (PubChem CID 71761143) has the molecular formula C29H35NO4 and a molecular weight of 461.60 g/mol. Its IUPAC name is (2R,4aR,9aR)-5-methoxy-7-[(E)-2-(4-methoxy-1-methylindol-6-yl)ethenyl]-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-xanthen-2-ol.
| Compound Name | (2R,4aR,9aR)-5-methoxy-7-[(E)-2-(4-methoxy-1-methylindol-6-yl)ethenyl]-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-xanthen-2-ol |
|---|---|
| PubChem CID | 71761143 |
| Molecular Formula | C29H35NO4 |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | (2R,4aR,9aR)-5-methoxy-7-[(E)-2-(4-methoxy-1-methylindol-6-yl)ethenyl]-1,1,4a-trimethyl-3,4,9,9a-tetrahydro-2H-xanthen-2-ol |
| SMILES | COc1cc(/C=C/c2cc(OC)c3ccn(C)c3c2)cc2c1O[C@]1(C)CC[C@@H](O)C(C)(C)[C@H]1C2 |
| InChI | InChI=1S/C29H35NO4/c1-28(2)25-17-20-13-18(16-24(33-6)27(20)34-29(25,3)11-9-26(28)31)7-8-19-14-22-21(10-12-30(22)4)23(15-19)32-5/h7-8,10,12-16,25-26,31H,9,11,17H2,1-6H3/b8-7+/t25-,26-,29-/m1/s1 |
| InChIKey | LWJJHEHKPJENFP-GEDZTWKOSA-N |
| XLogP | 5.86 |
| TPSA | 52.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|