C36H29F4N5O4 — CID 71761383
4-[1-[(3-fluorophenyl)methyl]-2-oxo-5-[(2,3,4-trifluorophenyl)methyl]-3-pyridinyl]-1-[4-(4-imidazol-1-ylphenyl)piperazin-1-yl]butane-1,2,4-trione (PubChem CID 71761383) has the molecular formula C36H29F4N5O4 and a molecular weight of 671.65 g/mol. Its IUPAC name is 4-[1-[(3-fluorophenyl)methyl]-2-oxo-5-[(2,3,4-trifluorophenyl)methyl]-3-pyridinyl]-1-[4-(4-imidazol-1-ylphenyl)piperazin-1-yl]butane-1,2,4-trione.
| Compound Name | 4-[1-[(3-fluorophenyl)methyl]-2-oxo-5-[(2,3,4-trifluorophenyl)methyl]-3-pyridinyl]-1-[4-(4-imidazol-1-ylphenyl)piperazin-1-yl]butane-1,2,4-trione |
|---|---|
| PubChem CID | 71761383 |
| Molecular Formula | C36H29F4N5O4 |
| Molecular Weight | 671.65 g/mol |
| Exact Mass | 671.22 |
| IUPAC Name | 4-[1-[(3-fluorophenyl)methyl]-2-oxo-5-[(2,3,4-trifluorophenyl)methyl]-3-pyridinyl]-1-[4-(4-imidazol-1-ylphenyl)piperazin-1-yl]butane-1,2,4-trione |
| SMILES | O=C(CC(=O)c1cc(Cc2ccc(F)c(F)c2F)cn(Cc2cccc(F)c2)c1=O)C(=O)N1CCN(c2ccc(-n3ccnc3)cc2)CC1 |
| InChI | InChI=1S/C36H29F4N5O4/c37-26-3-1-2-23(17-26)20-45-21-24(16-25-4-9-30(38)34(40)33(25)39)18-29(35(45)48)31(46)19-32(47)36(49)43-14-12-42(13-15-43)27-5-7-28(8-6-27)44-11-10-41-22-44/h1-11,17-18,21-22H,12-16,19-20H2 |
| InChIKey | XLAYDERGVJGUKE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 97.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.65 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|