C24H32N2O4 — CID 71761447
(3S,8R)-3-ethenyl-8-[(5-methyl-1,2-oxazole-3-carbonyl)amino]heptadeca-4,6-diynoic acid (PubChem CID 71761447) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is (3S,8R)-3-ethenyl-8-[(5-methyl-1,2-oxazole-3-carbonyl)amino]heptadeca-4,6-diynoic acid.
| Compound Name | (3S,8R)-3-ethenyl-8-[(5-methyl-1,2-oxazole-3-carbonyl)amino]heptadeca-4,6-diynoic acid |
|---|---|
| PubChem CID | 71761447 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | (3S,8R)-3-ethenyl-8-[(5-methyl-1,2-oxazole-3-carbonyl)amino]heptadeca-4,6-diynoic acid |
| SMILES | C=C[C@@H](C#CC#C[C@@H](CCCCCCCCC)NC(=O)c1cc(C)on1)CC(=O)O |
| InChI | InChI=1S/C24H32N2O4/c1-4-6-7-8-9-10-11-15-21(25-24(29)22-17-19(3)30-26-22)16-13-12-14-20(5-2)18-23(27)28/h5,17,20-21H,2,4,6-11,15,18H2,1,3H3,(H,25,29)(H,27,28)/t20-,21+/m0/s1 |
| InChIKey | MVAHJCCUIMNECW-LEWJYISDSA-N |
| XLogP | 4.51 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|