C29H34N2O3 — CID 71761515
1-N,3-N-bis(4-tert-butylphenyl)-4-methoxybenzene-1,3-dicarboxamide (PubChem CID 71761515) has the molecular formula C29H34N2O3 and a molecular weight of 458.60 g/mol. Its IUPAC name is 1-N,3-N-bis(4-tert-butylphenyl)-4-methoxybenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(4-tert-butylphenyl)-4-methoxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 71761515 |
| Molecular Formula | C29H34N2O3 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | 1-N,3-N-bis(4-tert-butylphenyl)-4-methoxybenzene-1,3-dicarboxamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(C(C)(C)C)cc2)cc1C(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C29H34N2O3/c1-28(2,3)20-9-13-22(14-10-20)30-26(32)19-8-17-25(34-7)24(18-19)27(33)31-23-15-11-21(12-16-23)29(4,5)6/h8-18H,1-7H3,(H,30,32)(H,31,33) |
| InChIKey | NIUGCPRXJUUCOK-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |