C25H32FN3O — CID 71761625
(10R,15S)-12-[4-(4-fluorophenyl)-4-methoxybutyl]-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene (PubChem CID 71761625) has the molecular formula C25H32FN3O and a molecular weight of 409.55 g/mol. Its IUPAC name is (10R,15S)-12-[4-(4-fluorophenyl)-4-methoxybutyl]-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene.
| Compound Name | (10R,15S)-12-[4-(4-fluorophenyl)-4-methoxybutyl]-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene |
|---|---|
| PubChem CID | 71761625 |
| Molecular Formula | C25H32FN3O |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | (10R,15S)-12-[4-(4-fluorophenyl)-4-methoxybutyl]-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene |
| SMILES | COC(CCCN1CC[C@H]2[C@@H](C1)c1cccc3c1N2CCN3C)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H32FN3O/c1-27-15-16-29-22-12-14-28(17-21(22)20-5-3-6-23(27)25(20)29)13-4-7-24(30-2)18-8-10-19(26)11-9-18/h3,5-6,8-11,21-22,24H,4,7,12-17H2,1-2H3/t21-,22-,24?/m0/s1 |
| InChIKey | UTPFEPOBEBXQCN-AJVCAZFQSA-N |
| XLogP | 4.42 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |