C31H28N2O3 — CID 71761639
2-hydroxyethyl (4R,5R)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate (PubChem CID 71761639) has the molecular formula C31H28N2O3 and a molecular weight of 476.58 g/mol. Its IUPAC name is 2-hydroxyethyl (4R,5R)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate.
| Compound Name | 2-hydroxyethyl (4R,5R)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate |
|---|---|
| PubChem CID | 71761639 |
| Molecular Formula | C31H28N2O3 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 2-hydroxyethyl (4R,5R)-3-benzyl-2,4,5-triphenyl-4H-imidazole-5-carboxylate |
| SMILES | O=C(OCCO)[C@]1(c2ccccc2)N=C(c2ccccc2)N(Cc2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C31H28N2O3/c34-21-22-36-30(35)31(27-19-11-4-12-20-27)28(25-15-7-2-8-16-25)33(23-24-13-5-1-6-14-24)29(32-31)26-17-9-3-10-18-26/h1-20,28,34H,21-23H2/t28-,31-/m1/s1 |
| InChIKey | YVHVFXSZWBJQIV-GRKNLSHJSA-N |
| XLogP | 5.12 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |