C20H29IO4Si — CID 71761688
[(1R,2E)-3,7-dimethyl-1-trimethylsilylocta-2,6-dienyl] 2-(3-iodo-6-oxopyran-2-yl)acetate (PubChem CID 71761688) has the molecular formula C20H29IO4Si and a molecular weight of 488.44 g/mol. Its IUPAC name is [(1R,2E)-3,7-dimethyl-1-trimethylsilylocta-2,6-dienyl] 2-(3-iodo-6-oxopyran-2-yl)acetate.
| Compound Name | [(1R,2E)-3,7-dimethyl-1-trimethylsilylocta-2,6-dienyl] 2-(3-iodo-6-oxopyran-2-yl)acetate |
|---|---|
| PubChem CID | 71761688 |
| Molecular Formula | C20H29IO4Si |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | [(1R,2E)-3,7-dimethyl-1-trimethylsilylocta-2,6-dienyl] 2-(3-iodo-6-oxopyran-2-yl)acetate |
| SMILES | CC(C)=CCC/C(C)=C/[C@H](OC(=O)Cc1oc(=O)ccc1I)[Si](C)(C)C |
| InChI | InChI=1S/C20H29IO4Si/c1-14(2)8-7-9-15(3)12-20(26(4,5)6)25-19(23)13-17-16(21)10-11-18(22)24-17/h8,10-12,20H,7,9,13H2,1-6H3/b15-12+/t20-/m1/s1 |
| InChIKey | SNTKXWBZHDYARS-IZLCOFNUSA-N |
| XLogP | 5.27 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|